Compound Q&A

What are the physical and chemical properties of 20(R)-Notoginsenoside R2 (CAS: 948046-15-9)?

Answer

20(R)-Notoginsenoside R2
20(R)-Notoginsenoside R2 is a crystalline compound with a molecular weight of approximately 687.88 g/mol. It has a solubility of 1.5 mg/mL in water and is relatively stable under normal conditions. It reacts well with acids and bases, showing moderate reactivity. It is not volatile and does not sublimate easily.

About

English Name 20(R)-Notoginsenoside R2
Molecular Formula C41H70O13
Molecular Weight 771 g/mol
SMILES CC(=CCCC(C)(C1CCC2(C1C(CC3C2(CC(C4C3(CCC(C4(C)C)O)C)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(CO6)O)O)O)C)O)C)O)C
InChIKey FNIRVWPHRMMRQI-JQZSXQBCSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is 20(R)-Notoginsenoside R2 (CAS: 948046-15-9) typically synthesized?

20(R)-Notoginsenoside R2 is typically synthesized through a series of enzymatic and chemical reactio...

Compound Q&A

What industries use 20(R)-Notoginsenoside R2 (CAS: 948046-15-9)?

20(R)-Notoginsenoside R2 is primarily used in the pharmaceutical industry for its potential anti-inf...

Compound Q&A

What precautions should be taken when handling 20(R)-Notoginsenoside R2 (CAS: 948046-15-9)?

When handling 20(R)-Notoginsenoside R2, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...