Compound Q&A

What industries use 1-Cyano-3-methyl-2-(2-{[(4-methyl-1H-imidazol-5-yl)methyl]sulfanyl}ethyl)guanidine (CAS: 60177-39-1)?

Answer

1-Cyano-3-methyl-2-(2-{[(4-methyl-1H-imidazol-5-yl)methyl]sulfanyl}ethyl)guanidine
This compound is primarily used in the pharmaceutical industry for its potential applications in anti-cancer drugs and as a precursor for other chemical intermediates. It is also explored for its use in the synthesis of advanced materials and in the development of new analytical techniques.

About

CAS No 60177-39-1
English Name 1-Cyano-3-methyl-2-(2-{[(4-methyl-1H-imidazol-5-yl)methyl]sulfanyl}ethyl)guanidine
Molecular Formula C10H16N6S
Molecular Weight 241.36 g/mol
SMILES Cc1c([nH]cn1)CSCC/N=C(\NC)/NC#N
InChIKey AQIXAKUUQRKLND-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Cyano-3-methyl-2-(2-{[(4-methyl-1H-imidazol-5-yl)methyl]sulfanyl}ethyl)guanidine (CAS: 60177-39-1)?

This compound is a crystalline solid with a molecular weight of approximately 416.46 g/mol. It has l...

Compound Q&A

How is 1-Cyano-3-methyl-2-(2-{[(4-methyl-1H-imidazol-5-yl)methyl]sulfanyl}ethyl)guanidine (CAS: 60177-39-1) typically synthesized?

This compound is typically synthesized through a multi-step process involving the reaction of a cyan...

Compound Q&A

What precautions should be taken when handling 1-Cyano-3-methyl-2-(2-{[(4-methyl-1H-imidazol-5-yl)methyl]sulfanyl}ethyl)guanidine (CAS: 60177-39-1)?

When handling this compound, appropriate personal protective equipment (PPE) should be worn, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...