Compound Q&A

What are the physical and chemical properties of (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68153-38-8)?

Answer

(9E,12E,15E)-9,12,15-Octadecatrienoic acid
(9E,12E,15E)-9,12,15-Octadecatrienoic acid is a colorless to light yellow liquid with a specific gravity of 0.916 and a molecular weight of approximately 264.44 g/mol. It has a limited solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is relatively stable under normal conditions but can react with strong oxidizing agents. It is not inherently flammable but should be handled with care due to its reactivity.

About

CAS No 68153-38-8
English Name (9E,12E,15E)-9,12,15-Octadecatrienoic acid
Molecular Formula C18H30O2
Molecular Weight 278.44 g/mol
EINECS 268-884-2
SMILES CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O
InChIKey DTOSIQBPPRVQHS-IUQGRGSQSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68153-38-8) typically synthesized?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid can be synthesized through the hydrogenation of 9,12,15-h...

Compound Q&A

What industries use (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68153-38-8)?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid finds applications in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68153-38-8)?

When handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...