Compound Q&A

What are the main uses of 4-Ethylbenzenesulfonic acid (CAS: 98-69-1)?

Answer

4-Ethylbenzenesulfonic acid
4-Ethylbenzenesulfonic acid (CAS: 98-69-1) is primarily used as a reagent in organic synthesis, particularly in the preparation of various organic compounds. It also serves as a pH indicator in analytical chemistry and can be used in the production of certain pharmaceuticals and dyes.

About

CAS No 98-69-1
English Name 4-Ethylbenzenesulfonic acid
Molecular Formula C8H10O3S
Molecular Weight 186.23 g/mol
SMILES CCC1=CC=C(C=C1)S(=O)(=O)O
InChIKey BRIXOPDYGQCZFO-UHFFFAOYSA-N
Last Updated: 2025-10-09 22:25

Related Q&A

Compound Q&A

What is 4-Ethylbenzenesulfonic acid (CAS: 98-69-1)?

4-Ethylbenzenesulfonic acid (CAS: 98-69-1) is an organic compound with the molecular formula C9H11O3...

Compound Q&A

Is 4-Ethylbenzenesulfonic acid (CAS: 98-69-1) safe?

4-Ethylbenzenesulfonic acid (CAS: 98-69-1) is generally considered safe when handled with proper pre...

Compound Q&A

How should 4-Ethylbenzenesulfonic acid (CAS: 98-69-1) be stored?

4-Ethylbenzenesulfonic acid (CAS: 98-69-1) should be stored in a cool, dry place at a temperature no...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...