Compound Q&A

What are the main uses of 2-Amino-3-chloro-5-nitrobenzonitrile (CAS: 20352-84-5)?

Answer

Benzonitrile, 2-amino-3-chloro-5-nitro-
2-Amino-3-chloro-5-nitrobenzonitrile is primarily used in the synthesis of pharmaceutical intermediates and dyes. It also serves as a reagent in organic synthesis due to its reactive functionalities.

About

CAS No 20352-84-5
English Name Benzonitrile, 2-amino-3-chloro-5-nitro-
Molecular Formula C7H4ClN3O2
Molecular Weight 197.58 g/mol
SMILES C1=C(C=C(C(=C1C#N)N)Cl)[N+](=O)[O-]
InChIKey XVYNBLCPQVDRCH-UHFFFAOYSA-N
Last Updated: 2025-10-09 22:25

Related Q&A

Compound Q&A

What is 2-Amino-3-chloro-5-nitrobenzonitrile (CAS: 20352-84-5)?

2-Amino-3-chloro-5-nitrobenzonitrile is a colorless to white crystalline solid with a molecular form...

Compound Q&A

Is 2-Amino-3-chloro-5-nitrobenzonitrile (CAS: 20352-84-5) safe?

2-Amino-3-chloro-5-nitrobenzonitrile is generally considered safe when handled with appropriate prec...

Compound Q&A

How should 2-Amino-3-chloro-5-nitrobenzonitrile (CAS: 20352-84-5) be stored?

2-Amino-3-chloro-5-nitrobenzonitrile should be stored in a cool, dry, and tightly sealed container a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...