Compound Q&A

Is 2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3) safe?

Answer

2-(3-cyanophenyl)acetic acid
2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3) is generally considered safe under normal handling conditions. However, it should be handled with caution due to its irritant properties. Protective equipment such as gloves and goggles should be worn to minimize exposure.

About

CAS No 1878-71-3
English Name 2-(3-cyanophenyl)acetic acid
Molecular Formula C9H7NO2
Molecular Weight 161.16 g/mol
SMILES C1=CC(=CC(=C1)C#N)CC(=O)O
InChIKey ZNXMNKGBHYVNNE-UHFFFAOYSA-N
Last Updated: 2025-10-09 15:43

Related Q&A

Compound Q&A

What is 2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3)?

2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3) is an organic compound with the molecular formula C9H7...

Compound Q&A

What are the main uses of 2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3)?

2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3) is primarily used in the pharmaceutical industry for t...

Compound Q&A

How should 2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3) be stored?

2-(3-cyanophenyl)acetic acid (CAS: 1878-71-3) should be stored in a cool, dry place away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...