Compound Q&A

What is 4-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 141179-72-8)?

Answer

4-Fluoro-2-(trifluoromethyl)benzoic acid
4-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 141179-72-8) is an organic compound characterized by its aromatic structure with a fluorine atom and three fluorine atoms attached to the methyl group. It is used in pharmaceuticals for its potential as a drug intermediate and in research for its biochemical activity.

About

English Name 4-Fluoro-2-(trifluoromethyl)benzoic acid
Molecular Formula C8H4F4O2
Molecular Weight 208.11 g/mol
SMILES C1=CC(=C(C=C1F)C(F)(F)F)C(=O)O
InChIKey JUHPDXOIGLHXTC-UHFFFAOYSA-N
Last Updated: 2025-10-09 15:43

Related Q&A

Compound Q&A

What are the main uses of 4-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 141179-72-8)?

4-Fluoro-2-(trifluoromethyl)benzoic acid is primarily used as a pharmaceutical intermediate in the d...

Compound Q&A

Is 4-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 141179-72-8) safe?

4-Fluoro-2-(trifluoromethyl)benzoic acid is generally safe when handled with appropriate precautions...

Compound Q&A

How should 4-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 141179-72-8) be stored?

4-Fluoro-2-(trifluoromethyl)benzoic acid should be stored in a cool, dry place away from direct sunl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...