Compound Q&A

What are the main uses of 4-Benzyl-2-(1-naphthyl)-1,2,4-thiadiazolidine-3,5-dione (CAS: 865854-05-3)?

Answer

4-Benzyl-2-(1-naphthyl)-1,2,4-thiadiazolidine-3,5-dione
This compound is primarily used in the pharmaceutical industry as a precursor or intermediate in the synthesis of other compounds. It also finds applications in research and development for its unique chemical properties.

About

English Name 4-Benzyl-2-(1-naphthyl)-1,2,4-thiadiazolidine-3,5-dione
Molecular Formula C19H14N2O2S
Molecular Weight 334.4 g/mol
SMILES c1ccc(cc1)Cn2c(=O)n(sc2=O)c3cccc4c3cccc4
InChIKey PMJIHLSCWIDGMD-UHFFFAOYSA-N
Last Updated: 2025-10-09 15:43

Related Q&A

Compound Q&A

What is 4-Benzyl-2-(1-naphthyl)-1,2,4-thiadiazolidine-3,5-dione (CAS: 865854-05-3)?

4-Benzyl-2-(1-naphthyl)-1,2,4-thiadiazolidine-3,5-dione is a thioether compound with a molecular str...

Compound Q&A

Is 4-Benzyl-2-(1-naphthyl)-1,2,4-thiadiazolidine-3,5-dione (CAS: 865854-05-3) safe?

The compound is generally considered safe when handled with appropriate precautions. However, it sho...

Compound Q&A

How should 4-Benzyl-2-(1-naphthyl)-1,2,4-thiadiazolidine-3,5-dione (CAS: 865854-05-3) be stored?

This compound should be stored in a cool, dry place away from heat and open flames. It should be kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...