Compound Q&A

Is 4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6) safe?

Answer

4-(1H-Pyrazol-4-yl)benzoic acid
4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6) is generally considered safe when handled with appropriate precautions. It is important to follow standard safety protocols, including wearing appropriate personal protective equipment (PPE) and ensuring proper ventilation during handling. Avoid contact with skin and eyes, and dispose of waste materials in a responsible manner.

About

English Name 4-(1H-Pyrazol-4-yl)benzoic acid
Molecular Formula C10H8N2O2
Molecular Weight 188.19 g/mol
SMILES C1=CC(=CC=C1C2=CNN=C2)C(=O)O
InChIKey ZGICHEMKLPXWPZ-UHFFFAOYSA-N
Last Updated: 2025-10-09 11:55

Related Q&A

Compound Q&A

What is 4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6)?

4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6) is an organic compound with the molecular formul...

Compound Q&A

What are the main uses of 4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6)?

4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6) is primarily used as an intermediate in the phar...

Compound Q&A

How should 4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6) be stored?

4-(1H-Pyrazol-4-yl)benzoic acid (CAS: 1017794-47-6) should be stored in a tightly sealed container i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...