Compound Q&A

What is Methyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885278-42-2)?

Answer

Methyl 6-bromo-1H-indazole-3-carboxylate
Methyl 6-bromo-1H-indazole-3-carboxylate is an organic compound with the CAS number 885278-42-2. It has the molecular formula C9H7BrNO2. This compound is characterized by its aromatic structure with a bromine substituent at position 6 and a carboxylate group at position 3. It is typically used in pharmaceuticals and research due to its structural features.

About

English Name Methyl 6-bromo-1H-indazole-3-carboxylate
Molecular Formula C9H7BrN2O2
Molecular Weight 255.07 g/mol
SMILES COC(=O)C1=NNC2=C1C=CC(=C2)Br
InChIKey FIPMZRPZSZXFGK-UHFFFAOYSA-N
Last Updated: 2025-10-09 11:55

Related Q&A

Compound Q&A

What are the main uses of Methyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885278-42-2)?

Methyl 6-bromo-1H-indazole-3-carboxylate is primarily used in the synthesis of pharmaceuticals, spec...

Compound Q&A

Is Methyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885278-42-2) safe?

Methyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885278-42-2) is generally safe when handled with appr...

Compound Q&A

How should Methyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885278-42-2) be stored?

Methyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885278-42-2) should be stored in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...