Compound Q&A

What is 2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine (CAS: 1197953-49-3)?

Answer

2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine
2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine is a complex organic compound with the CAS number 1197953-49-3. It is characterized by its molecular structure, which includes a pyrimidine ring, dichlorine substituents, and a dimethylphosphoryl group attached to a phenyl ring. This compound is typically found in pharmaceutical and research applications due to its unique chemical properties.

About

English Name 2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine
Molecular Formula C12H12Cl2N3OP
Molecular Weight 316.13 g/mol
SMILES CP(=O)(C)c1ccccc1Nc2c(cnc(n2)Cl)Cl
InChIKey XIKUAKVCJMVXCI-UHFFFAOYSA-N
Last Updated: 2025-10-09 11:55

Related Q&A

Compound Q&A

What are the main uses of 2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine (CAS: 1197953-49-3)?

2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine is primarily used in pharmaceutical r...

Compound Q&A

Is 2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine (CAS: 1197953-49-3) safe?

2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine (CAS: 1197953-49-3) is generally safe...

Compound Q&A

How should 2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine (CAS: 1197953-49-3) be stored?

2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine (CAS: 1197953-49-3) should be stored ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...