Compound Q&A

What is 2-Amino-4-nitrobenzoic acid (CAS: 619-17-0)?

Answer

2-Amino-4-nitrobenzoic acid
2-Amino-4-nitrobenzoic acid is an organic compound with the chemical formula C7H7N2O4. It is a white or light yellow crystalline solid with a melting point of 228-229°C. This compound is used in the synthesis of pharmaceuticals, dyes, and other organic compounds due to its functional groups.

About

CAS No 619-17-0
English Name 2-Amino-4-nitrobenzoic acid
Molecular Formula C7H6N2O4
Molecular Weight 182.13 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])N)C(=O)O
InChIKey UEALKTCRMBVTFN-UHFFFAOYSA-N
Last Updated: 2025-10-09 11:55

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-4-nitrobenzoic acid (CAS: 619-17-0)?

2-Amino-4-nitrobenzoic acid is primarily used in the pharmaceutical industry for the synthesis of dr...

Compound Q&A

Is 2-Amino-4-nitrobenzoic acid (CAS: 619-17-0) safe?

2-Amino-4-nitrobenzoic acid is generally considered safe for industrial use when proper safety measu...

Compound Q&A

How should 2-Amino-4-nitrobenzoic acid (CAS: 619-17-0) be stored?

2-Amino-4-nitrobenzoic acid should be stored in a cool, dry place, away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...