Compound Q&A

Are there alternatives to (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid (CAS: 80544-17-8) in synthesis?

Answer

(2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid
Alternatives to (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid (CAS: 80544-17-8) in synthesis include other thiazole derivatives with similar functional groups. Isomers and analogs like 2-amino-1,3-thiazole-4-carboxylic acid or related compounds can serve as viable alternatives. In some cases, substituting with simpler reagents such as amino acids or thiosemicarbazides might be considered, depending on the specific synthetic route and desired properties of the final product.

About

CAS No 80544-17-8
English Name (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid
Molecular Formula C8H9N3O5S
Molecular Weight 259.24 g/mol
SMILES COC(=O)CON=C(C1=CSC(=N1)N)C(=O)O
InChIKey AGFYEFQBXHONNW-WDZFZDKYSA-N
Last Updated: 2025-10-08 20:02

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid (CAS: 80544-17-8)?

This compound (CAS: 80544-17-8) falls under the scope of GHS classification, which requires it to be...

Compound Q&A

What is the market or research trend for (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid (CAS: 80544-17-8)?

The market and research trends for (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acet...

Compound Q&A

How should waste containing (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid (CAS: 80544-17-8) be handled?

Waste containing (2Z)-(2-Amino-1,3-thiazol-4-yl)[(2-methoxy-2-oxoethoxy)imino]acetic acid (CAS: 8054...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...