Compound Q&A

Are there alternatives to 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3) in synthesis?

Answer

3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid
In the synthesis of compounds similar to 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3), researchers often explore alternatives such as related diazo compounds or substituted benzoic acids. Common reagents include different aromatic amines and diazo reagents, which can serve as viable alternatives depending on the specific application and desired properties.

About

CAS No 20691-84-3
English Name 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid
Molecular Formula C15H15N3O2
Molecular Weight 269.3 g/mol
SMILES CN(C)C1=CC=C(C=C1)N=NC2=CC=CC(=C2)C(=O)O
InChIKey JAMPLPMVLCTBSB-WUKNDPDISA-N
Last Updated: 2025-10-08 20:02

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3)?

3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3) is subject to various regula...

Compound Q&A

What is the market or research trend for 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3)?

The market for 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3) is growing du...

Compound Q&A

How should waste containing 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3) be handled?

Waste containing 3-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid (CAS: 20691-84-3) should be c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...