Compound Q&A

Are there alternatives to 2-Methyl-2-proanylpiperidine-4-carboxylic acid methyl sulfone in synthesis?

Answer

2-Methyl-2-propanyl 4-[(methylsulfonyl)oxy]-1-piperidinecarboxylate
Several alternatives can be used in the synthesis of 2-Methyl-2-proanylpiperidine-4-carboxylic acid methyl sulfone. For instance, using 2-methyl-2-proanylpiperidine-4-carboxylic acid and methyl thiocyanate can serve as a viable alternative. Other reagents like methyl isothiocyanate or other sulfonating agents can also be considered based on reaction conditions and desired product purity.

About

English Name 2-Methyl-2-propanyl 4-[(methylsulfonyl)oxy]-1-piperidinecarboxylate
Molecular Formula C11H21NO5S
Molecular Weight 279.36 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)OS(=O)(=O)C
InChIKey WOEQSXAIPTXOPY-UHFFFAOYSA-N
Last Updated: 2025-10-08 07:30

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 4-[(methylsulfonyl)oxy]-1-piperidinecarboxylate (CAS: 141699-59-4)?

2-Methyl-2-propanyl 4-[(methylsulfonyl)oxy]-1-piperidinecarboxylate (CAS: 141699-59-4) is subject to...

Compound Q&A

What is the market or research trend for 2-Methyl-2-proanylpiperidine-4-carboxylic acid methyl sulfone (CAS: 141699-59-4)?

The market for 2-Methyl-2-proanylpiperidine-4-carboxylic acid methyl sulfone (CAS: 141699-59-4) is s...

Compound Q&A

How should waste containing 2-Methyl-2-proanylpiperidine-4-carboxylic acid methyl sulfone (CAS: 141699-59-4) be handled?

Waste containing 2-Methyl-2-proanylpiperidine-4-carboxylic acid methyl sulfone (CAS: 141699-59-4) sh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...