Compound Q&A

Are there alternatives to (1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 84976-67-0) in synthesis?

Answer

(1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
While (1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid is a specific compound, there are alternatives such as other bi-cyclohexyl derivatives or similar carboxylic acids. Commonly, chemists may explore isomers or analogs with similar functional groups for synthesis purposes. Additionally, alternative reagents like ethyl acetate or other carboxylic acids can serve as substitutes depending on the specific reaction conditions and desired product.

About

CAS No 84976-67-0
English Name (1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid
Molecular Formula C15H26O2
Molecular Weight 238.37 g/mol
SMILES O=C([C@H]1CC[C@H](C2CCC(CC)CC2)CC1)O
InChIKey OQIHEFMTIUJJET-HDRKRICHSA-N
Last Updated: 2025-10-08 07:30

Related Q&A

Compound Q&A

What regulatory guidelines apply to (1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 84976-67-0)?

This compound falls under the scope of REACH regulations for chemical safety and management. It also...

Compound Q&A

What is the market or research trend for (1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 84976-67-0)?

Currently, research in the field of biocatalysis and chiral synthesis has shown increased interest i...

Compound Q&A

How should waste containing (1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid (CAS: 84976-67-0) be handled?

Waste containing (1r,1'r,4S,4'S)-4'-Ethyl-1,1'-bi(cyclohexyl)-4-carboxylic acid should be collected ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...