Compound Q&A

How is 1,10-Phenanthroline-2,9-dicarboxylic acid (CAS: 57709-61-2) typically synthesized?

Answer

1,10-Phenanthroline-2,9-dicarboxylic acid
1,10-Phenanthroline-2,9-dicarboxylic acid is typically synthesized by the oxidation of 1,10-phenanthroline with nitric acid or potassium permanganate. Common methods include the oxidation of 1,10-phenanthroline in sulfuric acid or phosphoric acid medium. The product is purified by recrystallization from ethanol or water, and yields are generally around 80-90%.

About

CAS No 57709-61-2
English Name 1,10-Phenanthroline-2,9-dicarboxylic acid
Molecular Formula C14H8N2O4
Molecular Weight 268.23 g/mol
SMILES C1=CC2=C(C3=C1C=CC(=N3)C(=O)O)N=C(C=C2)C(=O)O
InChIKey FXSVCROWUPWXBP-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,10-Phenanthroline-2,9-dicarboxylic acid (CAS: 57709-61-2)?

1,10-Phenanthroline-2,9-dicarboxylic acid is a yellow crystalline solid with a molecular weight of 2...

Compound Q&A

What industries use 1,10-Phenanthroline-2,9-dicarboxylic acid (CAS: 57709-61-2)?

1,10-Phenanthroline-2,9-dicarboxylic acid is widely used in the pharmaceutical industry for metal co...

Compound Q&A

What precautions should be taken when handling 1,10-Phenanthroline-2,9-dicarboxylic acid (CAS: 57709-61-2)?

When handling 1,10-Phenanthroline-2,9-dicarboxylic acid, wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...