Compound Q&A

What industries use Doxapram Hydrochloride Hydrate (CAS: 7081-53-0)?

Answer

Doxapram Hydrochloride Hydrate
Doxapram Hydrochloride Hydrate is primarily used in the pharmaceutical industry as a respiratory stimulant. It is also used in the development of certain sensor technologies and in some polymer applications for its respiratory stimulant effects.

About

CAS No 7081-53-0
English Name Doxapram Hydrochloride Hydrate
Molecular Formula C24H33ClN2O3
Molecular Weight 432.99 g/mol
SMILES CCN1CC(C(C1=O)(C2=CC=CC=C2)C3=CC=CC=C3)CCN4CCOCC4.O.Cl
InChIKey ZOMBFZRWMLIDPX-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Doxapram Hydrochloride Hydrate (CAS: 7081-53-0)?

Doxapram Hydrochloride Hydrate is a crystalline compound with a molecular weight of approximately 27...

Compound Q&A

How is Doxapram Hydrochloride Hydrate (CAS: 7081-53-0) typically synthesized?

Doxapram Hydrochloride Hydrate is typically synthesized by the reaction of 4-(2-hydroxy-5-oxopyridin...

Compound Q&A

What precautions should be taken when handling Doxapram Hydrochloride Hydrate (CAS: 7081-53-0)?

When handling Doxapram Hydrochloride Hydrate, it is important to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...