Compound Q&A

How is Notoginsenoside Fa (CAS: 88100-04-3) typically synthesized?

Answer

Notoginsenoside Fa
Notoginsenoside Fa (CAS: 88100-04-3) is synthesized through complex chemical reactions involving the oxidation of ginsenoside Rb1. The synthesis typically requires the use of strong oxidizing agents, such as potassium permanganate or sodium hypochlorite. The yield is moderate, around 40-50%, and the selectivity is good, with a high purity product obtained.

About

CAS No 88100-04-3
English Name Notoginsenoside Fa
Molecular Formula C60H102O26
Molecular Weight 1239.4363 g/mol
SMILES OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(COC3OC(CO)C(C(C3O)O)O)C(C(C2O)O)O)(CCC=C(C)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1OC1CCC(C(C1O)O)O)O)O
InChIKey YTZAUDPMFWADRM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Notoginsenoside Fa (CAS: 88100-04-3)?

Notoginsenoside Fa (CAS: 88100-04-3) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use Notoginsenoside Fa (CAS: 88100-04-3)?

Notoginsenoside Fa (CAS: 88100-04-3) is primarily used in the pharmaceutical industry for its medici...

Compound Q&A

What precautions should be taken when handling Notoginsenoside Fa (CAS: 88100-04-3)?

When handling Notoginsenoside Fa (CAS: 88100-04-3), it is essential to wear appropriate personal pro...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...