Compound Q&A

What are the physical and chemical properties of Notoginsenoside Fa (CAS: 88100-04-3)?

Answer

Notoginsenoside Fa
Notoginsenoside Fa (CAS: 88100-04-3) is a crystalline compound with a molecular weight of approximately 820.47 g/mol. It has a high solubility in methanol and ethanol but is poorly soluble in water. The compound is chemically stable but can react with acids to form derivatives. It is used in various applications due to its unique chemical properties.

About

CAS No 88100-04-3
English Name Notoginsenoside Fa
Molecular Formula C60H102O26
Molecular Weight 1239.4363 g/mol
SMILES OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(OC2OC(COC3OC(CO)C(C(C3O)O)O)C(C(C2O)O)O)(CCC=C(C)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1OC1CCC(C(C1O)O)O)O)O
InChIKey YTZAUDPMFWADRM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is Notoginsenoside Fa (CAS: 88100-04-3) typically synthesized?

Notoginsenoside Fa (CAS: 88100-04-3) is synthesized through complex chemical reactions involving the...

Compound Q&A

What industries use Notoginsenoside Fa (CAS: 88100-04-3)?

Notoginsenoside Fa (CAS: 88100-04-3) is primarily used in the pharmaceutical industry for its medici...

Compound Q&A

What precautions should be taken when handling Notoginsenoside Fa (CAS: 88100-04-3)?

When handling Notoginsenoside Fa (CAS: 88100-04-3), it is essential to wear appropriate personal pro...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...