Compound Q&A

How is Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate (CAS: 179688-26-7) typically synthesized?

Answer

Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate
Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate is typically synthesized via nitration of 4,5-bis(2-methoxyethoxy)-2-nitrobenzoic acid using concentrated nitric acid. This process requires careful control of temperature and concentration to achieve high yield and selectivity. The reaction is usually carried out in a solvent like acetic acid or toluene, with the product isolated by crystallization.

About

English Name Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate
Molecular Formula C15H21NO8
Molecular Weight 343.33 g/mol
SMILES CCOC(=O)C1=CC(=C(C=C1[N+](=O)[O-])OCCOC)OCCOC
InChIKey VOHOFZNVWZWVMA-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate (CAS: 179688-26-7)?

Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate is a crystalline compound with a molecular weight of ...

Compound Q&A

What industries use Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate (CAS: 179688-26-7)?

Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate is used in the pharmaceutical industry as an intermed...

Compound Q&A

What precautions should be taken when handling Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate (CAS: 179688-26-7)?

When handling Ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate, appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...