Compound Q&A

What industries use methyl 2-bromo-6-methylbenzoate (CAS: 99548-56-8)?

Answer

Methyl 2-bromo-6-methylbenzoate
Methyl 2-bromo-6-methylbenzoate is used in various industries. It is a key intermediate in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the chemical industry as a starting material for making dyes and other organic compounds. Additionally, it is used in the polymer industry for the synthesis of certain polymers with specialized properties.

About

CAS No 99548-56-8
English Name Methyl 2-bromo-6-methylbenzoate
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES CC1=C(C(=CC=C1)Br)C(=O)OC
InChIKey DDJSNWUTQDNGIZ-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-bromo-6-methylbenzoate (CAS: 99548-56-8)?

Methyl 2-bromo-6-methylbenzoate is a crystalline solid with a molecular weight of approximately 251....

Compound Q&A

How is methyl 2-bromo-6-methylbenzoate (CAS: 99548-56-8) typically synthesized?

Methyl 2-bromo-6-methylbenzoate is typically synthesized through a halo substitution reaction of met...

Compound Q&A

What precautions should be taken when handling methyl 2-bromo-6-methylbenzoate (CAS: 99548-56-8)?

When handling methyl 2-bromo-6-methylbenzoate, it is important to use personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...