Compound Q&A

How is (3beta,12beta,14beta)-3,8,14,17-Tetrahydroxy-20-oxopregn-5-en-12-yl 4-hydroxybenzoate (CAS: 84745-94-8) typically synthesized?

Answer

(3beta,12beta,14beta)-3,8,14,17-Tetrahydroxy-20-oxopregn-5-en-12-yl 4-hydroxybenzoate
The compound is synthesized via a multi-step process involving saponification, esterification, and selective oxidation of a pregnenolone derivative. Commonly, sodium hydroxide is used for saponification, while sodium hypochlorite is utilized for the oxidation step.

About

CAS No 84745-94-8
English Name (3beta,12beta,14beta)-3,8,14,17-Tetrahydroxy-20-oxopregn-5-en-12-yl 4-hydroxybenzoate
Molecular Formula C28H36O8
Molecular Weight 500.59 g/mol
SMILES CC(=O)[C@@]1(CC[C@]2([C@@]1([C@@H](C[C@H]3[C@]2(CC=C4[C@@]3(CC[C@@H](C4)O)C)O)OC(=O)c5ccc(cc5)O)C)O)O
InChIKey IMRGSWAJVVVYOW-ZCARJHNXSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta,12beta,14beta)-3,8,14,17-Tetrahydroxy-20-oxopregn-5-en-12-yl 4-hydroxybenzoate (CAS: 84745-94-8)?

This compound is a steroid derivative with a molecular weight of approximately 518.56 g/mol. It is s...

Compound Q&A

What industries use (3beta,12beta,14beta)-3,8,14,17-Tetrahydroxy-20-oxopregn-5-en-12-yl 4-hydroxybenzoate (CAS: 84745-94-8)?

This compound is primarily used in the pharmaceutical industry for its anti-inflammatory and analges...

Compound Q&A

What precautions should be taken when handling (3beta,12beta,14beta)-3,8,14,17-Tetrahydroxy-20-oxopregn-5-en-12-yl 4-hydroxybenzoate (CAS: 84745-94-8)?

When handling this compound, use appropriate personal protective equipment (PPE) including gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...