Compound Q&A

What are the physical and chemical properties of Dimethylcurcumin (CAS: 52328-98-0)?

Answer

Dimethylcurcumin
Dimethylcurcumin (CAS: 52328-98-0) is a yellow crystalline compound with a molecular weight of approximately 306.23 g/mol. It has good solubility in organic solvents such as ethanol and acetone but is insoluble in water. It is relatively stable under normal conditions but reacts with bases to form curcumin. It is used in the synthesis of other compounds and in the food industry as a coloring agent.

About

CAS No 52328-98-0
English Name Dimethylcurcumin
Molecular Formula C23H24O6
Molecular Weight 396.4 g/mol
SMILES COC1=C(C=C(C=C1)C=CC(=CC(=O)C=CC2=CC(=C(C=C2)OC)OC)O)OC
InChIKey ZMGUKFHHNQMKJI-CIOHCNBKSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is Dimethylcurcumin (CAS: 52328-98-0) typically synthesized?

Dimethylcurcumin is typically synthesized by reacting curcumin with dimethyl sulfate in the presence...

Compound Q&A

What industries use Dimethylcurcumin (CAS: 52328-98-0)?

Dimethylcurcumin (CAS: 52328-98-0) is primarily used in the pharmaceutical and food industries. It i...

Compound Q&A

What precautions should be taken when handling Dimethylcurcumin (CAS: 52328-98-0)?

Dimethylcurcumin should be handled with personal protective equipment (PPE), including gloves and sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...