Compound Q&A

What industries use 1-Methyl-3-n-octylimidazolium Tetrafluoroborate (CAS: 244193-52-0)?

Answer

1-Methyl-3-n-octylimidazolium Tetrafluoroborate
1-Methyl-3-n-octylimidazolium Tetrafluoroborate is used in the pharmaceutical industry for its stability and solubility properties. It is also employed in the polymer industry for modifying polymer properties and in the development of sensors for detecting various analytes. Additionally, it is used in the semiconductor industry as a component in some electrolytes.

About

English Name 1-Methyl-3-n-octylimidazolium Tetrafluoroborate
Molecular Formula C12H23BF4N2
Molecular Weight 282.13 g/mol
SMILES [B-](F)(F)(F)F.CCCCCCCCN1C=C[N+](=C1)C
InChIKey GXZCAMSPWNHTAE-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methyl-3-n-octylimidazolium Tetrafluoroborate (CAS: 244193-52-0)?

1-Methyl-3-n-octylimidazolium Tetrafluoroborate is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 1-Methyl-3-n-octylimidazolium Tetrafluoroborate (CAS: 244193-52-0) typically synthesized?

1-Methyl-3-n-octylimidazolium Tetrafluoroborate is synthesized by reacting 1-methyl-3-n-octylimidazo...

Compound Q&A

What precautions should be taken when handling 1-Methyl-3-n-octylimidazolium Tetrafluoroborate (CAS: 244193-52-0)?

When handling 1-Methyl-3-n-octylimidazolium Tetrafluoroborate, always wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...