Compound Q&A

What are the physical and chemical properties of Sephadex G 25 (CAS: 9041-35-4)?

Answer

Sephadex G 25
Sephadex G 25 (CAS: 9041-35-4) is a hydroxyalkylated dextran-based matrix, typically in a cross-linked form. It has a molecular weight of approximately 250 kDa. The compound is insoluble in water and most organic solvents but is partially soluble in aqueous solutions. It exhibits moderate chemical reactivity due to its hydroxyl groups, which can participate in various chemical reactions under appropriate conditions.

About

CAS No 9041-35-4
English Name Sephadex G 25
Molecular Formula C9H20O9
Molecular Weight 272.25 g/mol
SMILES C(C1C(C(C(C(O1)O)O)O)O)O.C(C(CO)O)O
InChIKey BCPVZFFJGCURNR-OCOFDJSDSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is Sephadex G 25 (CAS: 9041-35-4) typically synthesized?

Sephadex G 25 (CAS: 9041-35-4) is synthesized through a process involving the cross-linking of dextr...

Compound Q&A

What industries use Sephadex G 25 (CAS: 9041-35-4)?

Sephadex G 25 (CAS: 9041-35-4) is widely used in the pharmaceutical industry for chromatography and ...

Compound Q&A

What precautions should be taken when handling Sephadex G 25 (CAS: 9041-35-4)?

When handling Sephadex G 25 (CAS: 9041-35-4), it is important to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...