Compound Q&A

What are the physical and chemical properties of N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6)?

Answer

N-Benzyl-N,N-diethylethanaminium hydroxide
N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6) is a crystalline compound with a molecular weight of approximately 238.31 g/mol. It has a basic nature and is soluble in water. The compound shows moderate reactivity, particularly with acidic substances. It has a pungent odor and is used in various applications due to its basic properties and solubility characteristics.

About

CAS No 1836-42-6
English Name N-Benzyl-N,N-diethylethanaminium hydroxide
Molecular Formula C13H23NO
Molecular Weight 209.33 g/mol
SMILES CC[N+](CC)(CC)CC1=CC=CC=C1.[OH-]
InChIKey FKPSBYZGRQJIMO-UHFFFAOYSA-M
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6) typically synthesized?

N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6) is synthesized through a multi-step proc...

Compound Q&A

What industries use N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6)?

N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6) finds application in various industries....

Compound Q&A

What precautions should be taken when handling N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6)?

When handling N-Benzyl-N,N-diethylethanaminium hydroxide (CAS: 1836-42-6), it is important to use pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...