Compound Q&A

What are the physical and chemical properties of Methyl 3-(4-formylphenyl)acrylate (CAS: 7560-50-1)?

Answer

Methyl 3-(4-formylphenyl)acrylate
Methyl 3-(4-formylphenyl)acrylate is a colorless to slightly yellow liquid with a molecular weight of approximately 186.23 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is poorly soluble in water. This compound is relatively stable at room temperature but reacts with strong bases and acids. It is used in various chemical applications due to its reactivity and functionality.

About

CAS No 7560-50-1
English Name Methyl 3-(4-formylphenyl)acrylate
Molecular Formula C11H10O3
Molecular Weight 190.2 g/mol
SMILES COC(=O)C=CC1=CC=C(C=C1)C=O
InChIKey KVXMLLMZXPRPNG-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is Methyl 3-(4-formylphenyl)acrylate (CAS: 7560-50-1) typically synthesized?

Methyl 3-(4-formylphenyl)acrylate is typically synthesized via the esterification reaction between 3...

Compound Q&A

What industries use Methyl 3-(4-formylphenyl)acrylate (CAS: 7560-50-1)?

Methyl 3-(4-formylphenyl)acrylate (CAS: 7560-50-1) is utilized in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Methyl 3-(4-formylphenyl)acrylate (CAS: 7560-50-1)?

When handling methyl 3-(4-formylphenyl)acrylate (CAS: 7560-50-1), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...