Compound Q&A

What industries use Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate (CAS: 49705-98-8)?

Answer

Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate
Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate (CAS: 49705-98-8) is used in the pharmaceutical and biochemical industries for its functional groups, which can be further modified to create novel drug candidates. It also finds applications in the synthesis of chiral compounds and as a building block in organic synthesis for the development of new materials.

About

CAS No 49705-98-8
English Name Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate
Molecular Formula C12H16N2O4
Molecular Weight 252.27 g/mol
SMILES CC(C(C(=O)N)NC(=O)OCC1=CC=CC=C1)O
InChIKey PYZXYZOBPGPOFQ-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate (CAS: 49705-98-8)?

Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate (CAS: 49705-98-8) is a colorless solid with a mo...

Compound Q&A

How is Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate (CAS: 49705-98-8) typically synthesized?

Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate is typically synthesized via the reaction of ben...

Compound Q&A

What precautions should be taken when handling Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate (CAS: 49705-98-8)?

When handling Benzyl (1-amino-3-hydroxy-1-oxo-2-butanyl)carbamate (CAS: 49705-98-8), safety glasses ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...