Compound Q&A

How is Cephapirin Benzathine (CAS: 97468-37-6) typically synthesized?

Answer

Cephapirin Benzathine
Cephapirin Benzathine is synthesized through the benzathine salt formation of cephapirin. This process involves the reaction of cephapirin with benzathine hydrochloride in the presence of a suitable solvent. The reaction is conducted under mild conditions to achieve a high yield and good selectivity.

About

CAS No 97468-37-6
English Name Cephapirin Benzathine
Molecular Formula C50H54N8O12S4
Molecular Weight 1087.27 g/mol
SMILES CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CSC3=CC=NC=C3)SC1)C(=O)O.CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CSC3=CC=NC=C3)SC1)C(=O)O.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2
InChIKey JAHKOXGROZNHHG-RACYMRPCSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cephapirin Benzathine (CAS: 97468-37-6)?

Cephapirin Benzathine is a white to off-white crystalline powder. Its molecular weight is approximat...

Compound Q&A

What industries use Cephapirin Benzathine (CAS: 97468-37-6)?

Cephapirin Benzathine is primarily used in the pharmaceutical industry for its antibiotic properties...

Compound Q&A

What precautions should be taken when handling Cephapirin Benzathine (CAS: 97468-37-6)?

When handling Cephapirin Benzathine, ensure proper personal protective equipment (PPE) including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...