Compound Q&A

How is Cephapirin Benzathine (CAS: 97468-37-6) typically synthesized?

Answer

Cephapirin Benzathine
Cephapirin Benzathine is synthesized through the benzathine salt formation of cephapirin. This process involves the reaction of cephapirin with benzathine hydrochloride in the presence of a suitable solvent. The reaction is conducted under mild conditions to achieve a high yield and good selectivity.

About

CAS No 97468-37-6
English Name Cephapirin Benzathine
Molecular Formula C50H54N8O12S4
Molecular Weight 1087.2702 g/mol
SMILES CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CSC3=CC=NC=C3)SC1)C(=O)O.CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CSC3=CC=NC=C3)SC1)C(=O)O.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2
InChIKey JAHKOXGROZNHHG-RACYMRPCSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cephapirin Benzathine (CAS: 97468-37-6)?

Cephapirin Benzathine is a white to off-white crystalline powder. Its molecular weight is approximat...

Compound Q&A

What industries use Cephapirin Benzathine (CAS: 97468-37-6)?

Cephapirin Benzathine is primarily used in the pharmaceutical industry for its antibiotic properties...

Compound Q&A

What precautions should be taken when handling Cephapirin Benzathine (CAS: 97468-37-6)?

When handling Cephapirin Benzathine, ensure proper personal protective equipment (PPE) including glo...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...