Compound Q&A

What are the physical and chemical properties of (7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile (CAS: 861960-34-1)?

Answer

(7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile
(7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile is a colorless or white crystalline solid with a molecular weight of approximately 236.22 g/mol. It is slightly soluble in water but soluble in organic solvents like methanol, ethanol, and chloroform. The compound is relatively stable but can exhibit reactivity under certain conditions. It has a low melting point and is soluble in common solvents, making it suitable for various applications in chemical synthesis and research.

About

English Name (7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile
Molecular Formula C13H13NO
Molecular Weight 199.25 g/mol
SMILES COC1=CC2=C(CCC=C2CC#N)C=C1
InChIKey MGJHVZKRAOYORH-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is (7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile (CAS: 861960-34-1) typically synthesized?

(7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile can be synthesized through the reaction of naphth...

Compound Q&A

What industries use (7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile (CAS: 861960-34-1)?

(7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile is used in various industries, including pharmace...

Compound Q&A

What precautions should be taken when handling (7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile (CAS: 861960-34-1)?

When handling (7-Methoxy-3,4-dihydro-1-naphthalenyl)acetonitrile, it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...