Compound Q&A

What are the physical and chemical properties of 4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0)?

Answer

4-Bromo-4’-propylbiphenyl
4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0) is a crystalline solid with a molecular weight of approximately 256.01 g/mol. It has a low water solubility and is sparingly soluble in common organic solvents. Chemically, it is less reactive under normal conditions but can undergo substitution reactions under appropriate conditions. It is stable under normal laboratory conditions but should be stored in a cool, dry place away from direct sunlight and heat sources.

About

CAS No 58743-81-0
English Name 4-Bromo-4’-propylbiphenyl
Molecular Formula C15H15Br
Molecular Weight 275.18 g/mol
SMILES CCCC1=CC=C(C=C1)C2=CC=C(C=C2)Br
InChIKey DPERLOMMOVDOHH-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0) typically synthesized?

4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0) is typically synthesized via bromination of 4-Propylbiph...

Compound Q&A

What industries use 4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0)?

4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0) finds applications in various industries, including phar...

Compound Q&A

What precautions should be taken when handling 4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0)?

When handling 4-Bromo-4’-propylbiphenyl (CAS: 58743-81-0), it is essential to wear protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...