Compound Q&A

How is Triphenylsulfonium chloride (CAS: 4270-70-6) typically synthesized?

Answer

Triphenylsulfonium chloride
Triphenylsulfonium chloride (CAS: 4270-70-6) is usually synthesized by treating phenylsulfonium triflate with hydrochloric acid. Commonly, this reaction occurs in anhydrous organic solvents, leading to a high yield of the product. The reaction is highly selective and can be performed at room temperature with appropriate stirring.

About

CAS No 4270-70-6
English Name Triphenylsulfonium chloride
Molecular Formula C18H15ClS
Molecular Weight 298.83 g/mol
SMILES c1ccc(cc1)[S+](c1ccccc1)c1ccccc1.[Cl-]
InChIKey ZFEAYIKULRXTAR-UHFFFAOYSA-M
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triphenylsulfonium chloride (CAS: 4270-70-6)?

Triphenylsulfonium chloride (CAS: 4270-70-6) is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use Triphenylsulfonium chloride (CAS: 4270-70-6)?

Triphenylsulfonium chloride (CAS: 4270-70-6) is widely used in the pharmaceutical industry for inter...

Compound Q&A

What precautions should be taken when handling Triphenylsulfonium chloride (CAS: 4270-70-6)?

When handling Triphenylsulfonium chloride (CAS: 4270-70-6), it is essential to wear protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...