Compound Q&A

What is 2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1)?

Answer

2-(4-Chloro-3-nitrobenzoyl)benzoic acid
2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1) is a white crystalline solid with the molecular formula C14H8ClNO4. It is highly soluble in water and has a pKa of approximately 3.7. This compound is widely used in the pharmaceutical and research industries due to its unique chemical properties.

About

CAS No 85-54-1
English Name 2-(4-Chloro-3-nitrobenzoyl)benzoic acid
Molecular Formula C14H8ClNO5
Molecular Weight 305.67 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-])C(=O)O
InChIKey RITAQDHCJBLSSL-UHFFFAOYSA-N
Last Updated: 2025-10-07 00:03

Related Q&A

Compound Q&A

What are the main uses of 2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1)?

2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1) is primarily used in the synthesis of other o...

Compound Q&A

Is 2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1) safe?

2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1) can be considered safe under proper handling ...

Compound Q&A

How should 2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1) be stored?

2-(4-Chloro-3-nitrobenzoyl)benzoic acid (CAS: 85-54-1) should be stored in a cool, dry place, away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...