Compound Q&A

What is Zirconium(2+) dicarbonate (CAS: 36577-48-7)?

Answer

Zirconium(2+) dicarbonate
Zirconium(2+) dicarbonate is a water-soluble inorganic compound. It has the chemical formula Zr(CO3)(H2O)2 and is used in various applications due to its chemical stability and solubility properties.

About

CAS No 36577-48-7
English Name Zirconium(2+) dicarbonate
Molecular Formula C2O5Zr
Molecular Weight 211.24 g/mol
SMILES C(=O)([O-])[O-].C(=O)([O-])[O-].[Zr+4]
InChIKey XVXQEGPLSMWWNB-UHFFFAOYSA-L
Last Updated: 2025-10-07 00:03

Related Q&A

Compound Q&A

What are the main uses of Zirconium(2+) dicarbonate (CAS: 36577-48-7)?

Zirconium(2+) dicarbonate is primarily used in pharmaceuticals as a buffering agent, in food additiv...

Compound Q&A

Is Zirconium(2+) dicarbonate (CAS: 36577-48-7) safe?

Zirconium(2+) dicarbonate is generally considered safe for most applications. However, prolonged exp...

Compound Q&A

How should Zirconium(2+) dicarbonate (CAS: 36577-48-7) be stored?

Zirconium(2+) dicarbonate should be stored in a cool, dry, and well-ventilated place away from direc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...