Compound Q&A

What are the main uses of 2-Chloro-6-nitrobenzoic acid (CAS: 5344-49-0)?

Answer

2-Chloro-6-nitrobenzoic acid
2-Chloro-6-nitrobenzoic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the production of dyes and as a reagent in analytical chemistry for spectroscopic analysis.

About

CAS No 5344-49-0
English Name 2-Chloro-6-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C(=C1)Cl)C(=O)O)[N+](=O)[O-]
InChIKey JYHOMEFOTKWQPN-UHFFFAOYSA-N
Last Updated: 2025-10-07 00:03

Related Q&A

Compound Q&A

What is 2-Chloro-6-nitrobenzoic acid (CAS: 5344-49-0)?

2-Chloro-6-nitrobenzoic acid is an organic compound with the chemical formula C7H4ClNO4. It is a whi...

Compound Q&A

Is 2-Chloro-6-nitrobenzoic acid (CAS: 5344-49-0) safe?

2-Chloro-6-nitrobenzoic acid is generally considered safe when handled with appropriate precautions....

Compound Q&A

How should 2-Chloro-6-nitrobenzoic acid (CAS: 5344-49-0) be stored?

2-Chloro-6-nitrobenzoic acid should be stored in a cool, dry place protected from moisture and light...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...