Compound Q&A

How should (2-Chloro-5-nitrophenyl)boronic acid (CAS: 867333-29-7) be stored?

Answer

(2-Chloro-5-nitrophenyl)boronic acid
(2-Chloro-5-nitrophenyl)boronic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Proper ventilation should be ensured during handling and storage to avoid the risk of combustion or explosion under certain conditions.

About

English Name (2-Chloro-5-nitrophenyl)boronic acid
Molecular Formula C6H5BClNO4
Molecular Weight 201.37 g/mol
SMILES OB(C1=CC([N+]([O-])=O)=CC=C1Cl)O
InChIKey KNFHCUNPMBSLRK-UHFFFAOYSA-N
Last Updated: 2025-10-07 00:03

Related Q&A

Compound Q&A

What is (2-Chloro-5-nitrophenyl)boronic acid (CAS: 867333-29-7)?

(2-Chloro-5-nitrophenyl)boronic acid is an organic compound with the molecular formula C8H5ClNO3B. I...

Compound Q&A

What are the main uses of (2-Chloro-5-nitrophenyl)boronic acid (CAS: 867333-29-7)?

(2-Chloro-5-nitrophenyl)boronic acid is primarily used in organic synthesis, serving as a boronic ac...

Compound Q&A

Is (2-Chloro-5-nitrophenyl)boronic acid (CAS: 867333-29-7) safe?

(2-Chloro-5-nitrophenyl)boronic acid is generally safe when handled with appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...