Compound Q&A

What is Dexrabeprazole sodium (CAS: 171440-18-9)?

Answer

Dexrabeprazole sodium
Dexrabeprazole sodium is a highly selective proton pump inhibitor used to treat gastric and duodenal ulcers, gastroesophageal reflux disease (GERD), and erosive esophagitis. It is a (S)-enantiomer of rabeprazole sodium, known for its enhanced efficacy and reduced side effects compared to racemic rabeprazole.

About

English Name Dexrabeprazole sodium
Molecular Formula C18H20N3NaO3S
Molecular Weight 381.42 g/mol
SMILES CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3[N-]2)OCCCOC.[Na+]
InChIKey KRCQSTCYZUOBHN-VQIWEWKSSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What are the main uses of Dexrabeprazole sodium (CAS: 171440-18-9)?

Dexrabeprazole sodium is primarily used for the treatment of gastric and duodenal ulcers, gastroesop...

Compound Q&A

Is Dexrabeprazole sodium (CAS: 171440-18-9) safe?

Dexrabeprazole sodium is generally considered safe for human use when administered as prescribed. Ho...

Compound Q&A

How should Dexrabeprazole sodium (CAS: 171440-18-9) be stored?

Dexrabeprazole sodium should be stored in a tightly closed container at room temperature (15°C to 30...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...