Compound Q&A

What are the main uses of 2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5)?

Answer

2,4,6-Trimethoxybenzoic acid
2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5) is primarily used in the pharmaceutical and research industries. It acts as a precursor in the synthesis of other chemical compounds and is also used in the production of some pharmaceuticals. Additionally, it has applications in analytical chemistry and as a reagent in organic synthesis.

About

CAS No 570-02-5
English Name 2,4,6-Trimethoxybenzoic acid
Molecular Formula C10H12O5
Molecular Weight 212.2 g/mol
SMILES COC1=CC(=C(C(=C1)OC)C(=O)O)OC
InChIKey JATAKEDDMQNPOQ-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What is 2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5)?

2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5) is an organic compound with the molecular formula C9H10...

Compound Q&A

Is 2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5) safe?

2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5) is generally considered safe when handled with appropri...

Compound Q&A

How should 2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5) be stored?

2,4,6-Trimethoxybenzoic acid (CAS: 570-02-5) should be stored in a cool, dry place, preferably in a ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...