Compound Q&A

What are the main uses of 2-Bromo-3,4,5-Trifluoro-1-Nitrobenzene (CAS: 1020718-01-7)?

Answer

2-Bromo-3,4,5-trifluoro-1-nitrobenzene
2-Bromo-3,4,5-Trifluoro-1-nitrobenzene is primarily used in the synthesis of pharmaceuticals, dyes, and other organic compounds. Its unique substituents make it valuable for developing new chemical entities in the pharmaceutical industry. Additionally, it is used in research for studying electrophilic aromatic substitution reactions.

About

English Name 2-Bromo-3,4,5-trifluoro-1-nitrobenzene
Molecular Formula C6HBrF3NO2
Molecular Weight 255.98 g/mol
SMILES c1c(c(c(c(c1F)F)F)Br)[N+](=O)[O-]
InChIKey RISQAVRTASTTPY-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What is 2-Bromo-3,4,5-Trifluoro-1-Nitrobenzene (CAS: 1020718-01-7)?

2-Bromo-3,4,5-Trifluoro-1-nitrobenzene is an organic compound with the CAS number 1020718-01-7. It i...

Compound Q&A

Is 2-Bromo-3,4,5-Trifluoro-1-Nitrobenzene (CAS: 1020718-01-7) safe?

While 2-Bromo-3,4,5-Trifluoro-1-nitrobenzene is generally safe when handled with appropriate precaut...

Compound Q&A

How should 2-Bromo-3,4,5-Trifluoro-1-Nitrobenzene (CAS: 1020718-01-7) be stored?

2-Bromo-3,4,5-Trifluoro-1-nitrobenzene should be stored in a cool, dry place, protected from light a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...