Compound Q&A

What are the main uses of 2-Chloro-5-nitrobenzoyl chloride (CAS: 25784-91-2)?

Answer

2-Chloro-5-nitrobenzoyl chloride
2-Chloro-5-nitrobenzoyl chloride is primarily used as an intermediate in the synthesis of pharmaceuticals and dyes. It plays a role in the production of certain organic compounds and is also utilized in research for developing new chemical compounds.

About

CAS No 25784-91-2
English Name 2-Chloro-5-nitrobenzoyl chloride
Molecular Formula C7H3Cl2NO3
Molecular Weight 220.01 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)Cl)Cl
InChIKey OGLKKYALUKXVPQ-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What is 2-Chloro-5-nitrobenzoyl chloride (CAS: 25784-91-2)?

2-Chloro-5-nitrobenzoyl chloride is an organic compound with the chemical formula C9H5ClNO2. It is a...

Compound Q&A

Is 2-Chloro-5-nitrobenzoyl chloride (CAS: 25784-91-2) safe?

2-Chloro-5-nitrobenzoyl chloride is generally safe when handled with proper protective measures. How...

Compound Q&A

How should 2-Chloro-5-nitrobenzoyl chloride (CAS: 25784-91-2) be stored?

2-Chloro-5-nitrobenzoyl chloride should be stored in a sealed, airtight container at room temperatur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...