Compound Q&A

What are the main uses of 3-Bromobenzenesulfonyl chloride (CAS: 2905-24-0)?

Answer

3-Bromobenzenesulfonyl chloride
3-Bromobenzenesulfonyl chloride is primarily used as an intermediate in the production of pharmaceuticals, dyes, and other organic compounds. It plays a crucial role in the synthesis of various drugs and chemical intermediates due to its reactive sulfonyl chloride functionality.

About

CAS No 2905-24-0
English Name 3-Bromobenzenesulfonyl chloride
Molecular Formula C6H4BrClO2S
Molecular Weight 255.52 g/mol
SMILES C1=CC(=CC(=C1)Br)S(=O)(=O)Cl
InChIKey PJGOLCXVWIYXRQ-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What is 3-Bromobenzenesulfonyl chloride (CAS: 2905-24-0)?

3-Bromobenzenesulfonyl chloride is a chemical compound with the molecular formula C8H6BrNO2. It is a...

Compound Q&A

Is 3-Bromobenzenesulfonyl chloride (CAS: 2905-24-0) safe?

3-Bromobenzenesulfonyl chloride is generally safe when handled with appropriate precautions. However...

Compound Q&A

How should 3-Bromobenzenesulfonyl chloride (CAS: 2905-24-0) be stored?

3-Bromobenzenesulfonyl chloride should be stored in a cool, dry place away from heat and sources of ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...