Compound Q&A

How should 4,4'-Dibromo-4''-phenyltriphenylamine (CAS: 884530-69-2) be stored?

Answer

4,4'-Dibromo-4''-phenyltriphenylamine
4,4'-Dibromo-4''-phenyltriphenylamine should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to store the compound in a tightly sealed container to prevent contamination and degradation. Avoid storing it near incompatible materials such as reducing agents or flammable substances. Maintain a temperature controlled environment, ideally between 15-25°C, and monitor humidity levels to prevent moisture absorption.

About

English Name 4,4'-Dibromo-4''-phenyltriphenylamine
Molecular Formula C24H17Br2N
Molecular Weight 479.22 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)N(C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br
InChIKey BKJULDLPGWGCHY-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What is 4,4'-Dibromo-4''-phenyltriphenylamine (CAS: 884530-69-2)?

4,4'-Dibromo-4''-phenyltriphenylamine is a chemical compound with the CAS number 884530-69-2. It is ...

Compound Q&A

What are the main uses of 4,4'-Dibromo-4''-phenyltriphenylamine (CAS: 884530-69-2)?

4,4'-Dibromo-4''-phenyltriphenylamine is primarily used in the pharmaceutical industry for developin...

Compound Q&A

Is 4,4'-Dibromo-4''-phenyltriphenylamine (CAS: 884530-69-2) safe?

4,4'-Dibromo-4''-phenyltriphenylamine is generally considered safe for handling under appropriate pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...