Compound Q&A

What is Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS: 1343-78-8)?

Answer

Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate
Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate is a complex organic compound with a molecular formula of C17H17NO5. It is characterized by its specific functional groups such as an ester, a carboxylic acid, and an azabicyclo moiety. This compound is primarily used in pharmaceutical and chemical research for its unique structural features.

About

CAS No 1343-78-8
English Name Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate
Molecular Formula C17H19NO5
Molecular Weight 317.34 g/mol
SMILES CC1=C2C(=CC(=C1C(=O)O)O)C(=O)C3=C(C2=O)C(=C(C(=C3O)O)C4C(C(C(C(O4)CO)O)O)O)O
InChIKey FPEWJDXCHAXYMI-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What are the main uses of Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS: 1343-78-8)?

This compound is mainly utilized in pharmaceutical research for its potential as a starting material...

Compound Q&A

Is Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS: 1343-78-8) safe?

Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate is generally considered safe ...

Compound Q&A

How should Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS: 1343-78-8) be stored?

Methyl 3-(benzoyloxy)-8-formyl-8-azabicyclo[3.2.1]octane-2-carboxylate should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...