Compound Q&A

Are there alternatives to 2-Methyl-2-propanyl (14-amino-3,6,9,12-tetraoxatetradec-1-yl)carbamate (CAS: 811442-84-9) in synthesis?

Answer

2-Methyl-2-propanyl (14-amino-3,6,9,12-tetraoxatetradec-1-yl)carbamate
There are several alternatives that can be used in synthesis, such as 2-methyl-2-propanol derivatives or other amino-containing compounds. These alternatives can offer similar or different functional properties depending on the specific application. Substitutes should be chosen based on the desired chemical behavior and regulatory compliance.

About

English Name 2-Methyl-2-propanyl (14-amino-3,6,9,12-tetraoxatetradec-1-yl)carbamate
Molecular Formula C15H32N2O6
Molecular Weight 336.43 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCCOCCOCCN
InChIKey WCNWLERBLMBSOT-UHFFFAOYSA-N
Last Updated: 2025-10-05 19:44

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl (14-amino-3,6,9,12-tetraoxatetradec-1-yl)carbamate (CAS: 811442-84-9)?

This compound is subject to various regulatory guidelines including GHS classification for hazardous...

Compound Q&A

What is the market or research trend for 2-Methyl-2-propanyl (14-amino-3,6,9,12-tetraoxatetradec-1-yl)carbamate (CAS: 811442-84-9)?

The market for this compound is currently focused on its use in specific chemical applications. Rece...

Compound Q&A

How should waste containing 2-Methyl-2-propanyl (14-amino-3,6,9,12-tetraoxatetradec-1-yl)carbamate (CAS: 811442-84-9) be handled?

Waste containing this compound should be collected in appropriate containers and disposed of accordi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...