Compound Q&A

What industries use Tocopherol (CAS: 1406-18-4)?

Answer

Tocopherol
Tocopherol (CAS: 1406-18-4) is widely used in various industries. It is a key ingredient in the pharmaceutical sector for its antioxidant and vitamin E properties. In the food industry, it serves as a preservative to prevent rancidity. Additionally, it finds applications in the cosmetic industry as a skin conditioner. Tocopherol is also utilized in the polymer industry for stabilizing plastics and in the agricultural sector to improve feed quality.

About

CAS No 1406-18-4
English Name Tocopherol
Molecular Formula C29H50O2
Molecular Weight 430.71 g/mol
SMILES CC1=C(C2=C(CCC(O2)(C)CCCC(C)CCCC(C)CCCC(C)C)C(=C1O)C)C
InChIKey GVJHHUAWPYXKBD-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tocopherol (CAS: 1406-18-4)?

Tocopherol (CAS: 1406-18-4) is a crystalline, naturally occurring compound with a molecular weight o...

Compound Q&A

How is Tocopherol (CAS: 1406-18-4) typically synthesized?

Tocopherol (CAS: 1406-18-4) is typically synthesized through enzymatic or chemical methods. Commonly...

Compound Q&A

What precautions should be taken when handling Tocopherol (CAS: 1406-18-4)?

When handling Tocopherol (CAS: 1406-18-4), it is important to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...