Compound Q&A

What are the physical and chemical properties of 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) (CAS: 70643-20-8)?

Answer

2-(2,4-Diaminophenoxy)ethanol sulfate (1:1)
2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) (CAS: 70643-20-8) is a crystalline compound with a molecular weight of approximately 247.14 g/mol. It has good solubility in water and organic solvents. The compound is relatively stable but can react with strong acids to form sulfate salts. It has a pKa around 10.5, indicating basic properties.

About

CAS No 70643-20-8
English Name 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1)
Molecular Formula C8H14N2O6S
Molecular Weight 266.28 g/mol
SMILES NC1=CC=C(OCCO)C(N)=C1.O=S(O)(O)=O
InChIKey UUHBEKCQQLDQNG-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) (CAS: 70643-20-8) typically synthesized?

2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) can be synthesized by reacting 2-(2,4-diaminophenoxy)eth...

Compound Q&A

What industries use 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) (CAS: 70643-20-8)?

2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) (CAS: 70643-20-8) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) (CAS: 70643-20-8)?

When handling 2-(2,4-Diaminophenoxy)ethanol sulfate (1:1) (CAS: 70643-20-8), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...