Compound Q&A

What are the physical and chemical properties of 3,5-Dinitro-2-thiophenamine (CAS: 2045-70-7)?

Answer

3,5-Dinitro-2-thiophenamine
3,5-Dinitro-2-thiophenamine is a crystalline solid with a molecular weight of approximately 228.08 g/mol. It is poorly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards reducing agents and can undergo substitution reactions.

About

CAS No 2045-70-7
English Name 3,5-Dinitro-2-thiophenamine
Molecular Formula C4H3N3O4S
Molecular Weight 189.15 g/mol
SMILES C1=C(SC(=C1[N+](=O)[O-])N)[N+](=O)[O-]
InChIKey DZRZHFOFVWAKGT-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 3,5-Dinitro-2-thiophenamine (CAS: 2045-70-7) typically synthesized?

3,5-Dinitro-2-thiophenamine is synthesized by the nitration of 2-thiophenamine followed by further n...

Compound Q&A

What industries use 3,5-Dinitro-2-thiophenamine (CAS: 2045-70-7)?

3,5-Dinitro-2-thiophenamine is primarily used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 3,5-Dinitro-2-thiophenamine (CAS: 2045-70-7)?

When handling 3,5-Dinitro-2-thiophenamine, it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...