Compound Q&A

What industries use (2R)-2-{4-[(6-Chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoic acid (CAS: 113158-40-0)?

Answer

(2R)-2-{4-[(6-Chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoic acid
This compound is primarily used in the pharmaceutical industry due to its biological activity. It is also explored for its potential use in sensors and as a precursor in the synthesis of other molecules for various applications. Its use in polymers and semiconductors is limited but under investigation for specific applications.

About

English Name (2R)-2-{4-[(6-Chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoic acid
Molecular Formula C16H12ClNO5
Molecular Weight 333.73 g/mol
SMILES CC(C(=O)O)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl
InChIKey MPPOHAUSNPTFAJ-SECBINFHSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-{4-[(6-Chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoic acid (CAS: 113158-40-0)?

This compound is a white crystalline solid with a molecular weight of approximately 359.23 g/mol. It...

Compound Q&A

How is (2R)-2-{4-[(6-Chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoic acid (CAS: 113158-40-0) typically synthesized?

The compound can be synthesized via a multi-step process involving a Wittig reaction followed by an ...

Compound Q&A

What precautions should be taken when handling (2R)-2-{4-[(6-Chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoic acid (CAS: 113158-40-0)?

This compound should be handled in a fume hood to avoid inhalation of dust or vapors. Suitable perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...