Compound Q&A

What are the physical and chemical properties of TRIDECETH-4 (CAS: 69011-36-5)?

Answer

TRIDECETH-4
TRIDECETH-4 is a clear, slightly viscous liquid with a molecular weight of approximately 360 g/mol. It has good water solubility, making it soluble in water up to 50% by weight. Chemically, it is highly reactive with hydroxyl groups, making it useful in surfactant and emulsifier applications. It is stable under normal storage conditions but should be kept away from strong acids and bases.

About

CAS No 69011-36-5
English Name TRIDECETH-4
Molecular Formula C10H7NO2S
Molecular Weight 205.23 g/mol
SMILES S=C(C1C(=O)OC2C=CC=CC=2C=1)N
InChIKey NNHJYDSWYAVKNK-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is TRIDECETH-4 (CAS: 69011-36-5) typically synthesized?

TRIDECETH-4 is typically synthesized through the ethoxylation of 13-alkyl glycerol, using ethylene o...

Compound Q&A

What industries use TRIDECETH-4 (CAS: 69011-36-5)?

TRIDECETH-4 is widely used in the textile, personal care, and cleaning product industries due to its...

Compound Q&A

What precautions should be taken when handling TRIDECETH-4 (CAS: 69011-36-5)?

When handling TRIDECETH-4, proper personal protective equipment (PPE) should be worn, including glov...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...